CAS 455-00-5
:2,6-bis(trifluoromethyl)pyridine
Description:
2,6-Bis(trifluoromethyl)pyridine, with the CAS number 455-00-5, is a heterocyclic aromatic compound characterized by a pyridine ring substituted at the 2 and 6 positions with trifluoromethyl groups. This compound is known for its strong electron-withdrawing properties due to the presence of the trifluoromethyl groups, which can significantly influence its reactivity and interactions with other chemical species. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the trifluoromethyl groups enhances its lipophilicity and stability, making it useful in various applications, including as a building block in organic synthesis and in the development of pharmaceuticals. Additionally, 2,6-bis(trifluoromethyl)pyridine exhibits notable thermal stability and can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Its unique properties make it a valuable compound in both research and industrial contexts.
Formula:C7H3F6N
InChI:InChI=1/C7H3F6N/c8-6(9,10)4-2-1-3-5(14-4)7(11,12)13/h1-3H
SMILES:c1cc(C(F)(F)F)nc(c1)C(F)(F)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,6-Bis(trifluoromethyl)pyridine, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H3F6NPurity:97%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:215.102,6-Bis(trifluoromethyl)pyridine
CAS:Formula:C7H3F6NPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:215.102,6-Bis(trifluoromethyl)pyridine
CAS:2,6-Bis(trifluoromethyl)pyridinePurity:≥95%Color and Shape:White SolidMolecular weight:215.10g/mol2,6-Bis(trifluoromethyl)pyridine
CAS:Formula:C7H3F6NPurity:97%Color and Shape:SolidMolecular weight:215.0982,6-Bis(trifluoromethyl)pyridine
CAS:Formula:C7H3F6NPurity:97%Color and Shape:SolidMolecular weight:215.0958




