CAS 455-00-5

2,6-bis(trifluoromethyl)pyridine

Description:

2,6-Bis(trifluoromethyl)pyridine, with the CAS number 455-00-5, is a heterocyclic aromatic compound characterized by a pyridine ring substituted at the 2 and 6 positions with trifluoromethyl groups. This compound is known for its strong electron-withdrawing properties due to the presence of the trifluoromethyl groups, which can significantly influence its reactivity and interactions with other chemical species. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the trifluoromethyl groups enhances its lipophilicity and stability, making it useful in various applications, including as a building block in organic synthesis and in the development of pharmaceuticals. Additionally, 2,6-bis(trifluoromethyl)pyridine exhibits notable thermal stability and can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Its unique properties make it a valuable compound in both research and industrial contexts.

Formula: C₇H₃F₆N

InChI: InChI=1/C7H3F6N/c8-6(9,10)4-2-1-3-5(14-4)7(11,12)13/h1-3H

SMILES: c1cc(C(F)(F)F)nc(c1)C(F)(F)F

2,6-Bis(trifluoromethyl)pyridine, 97%

CAS: 455-00-5

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₇H₃F₆N

Purity: 97%

Color and Shape: White, Crystals or powder or crystalline powder

Molecular weight: 215.10

Ref: 02-L19446

2,6-Bis(trifluoromethyl)pyridine

CAS: 455-00-5

Formula: C₇H₃F₆N

Purity: 97%

Color and Shape: Solid

Molecular weight: 215.0958

Ref: IN-DA003G1T

2,6-Bis(trifluoromethyl)pyridine

CAS: 455-00-5

Formula: C₇H₃F₆N

Purity: >98.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 215.10

Ref: 3B-B2395

2,6-Bis(trifluoromethyl)pyridine

CAS: 455-00-5

2,6-Bis(trifluoromethyl)pyridine

Purity: ≥95%

Color and Shape: White Solid

Molecular weight: 215.10g/mol

Ref: 54-PC4026

2,6-Bis(trifluoromethyl)pyridine

CAS: 455-00-5

Formula: C₇H₃F₆N

Purity: 97%

Color and Shape: Solid

Molecular weight: 215.098

Ref: 10-F010225