CAS 455-84-5

4-Fluoro-3-methylbenzoyl chloride

Description:

4-Fluoro-3-methylbenzoyl chloride, with the CAS number 455-84-5, is an aromatic compound characterized by the presence of a benzoyl chloride functional group and a fluorine atom at the para position relative to the carbonyl group. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which can readily undergo nucleophilic substitution reactions. It is soluble in organic solvents such as dichloromethane and ether but is generally insoluble in water. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity and altering its physical properties compared to non-fluorinated analogs. 4-Fluoro-3-methylbenzoyl chloride is often utilized in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals, due to its ability to act as an acylating agent. As with many acyl chlorides, it should be handled with care due to its corrosive nature and potential to release hydrochloric acid upon reaction with water or alcohols.

Formula: C₈H₆ClFO

InChI: InChI=1/C8H6ClFO/c1-5-4-6(8(9)11)2-3-7(5)10/h2-4H,1H3

SMILES: Cc1cc(ccc1F)C(=O)Cl

Synonyms:

• 4-Fluoro-m-toluoyl chloride

4-Fluoro-3-methylbenzoyl Chloride

CAS: 455-84-5

Formula: C₈H₆ClFO

Purity: >98.0%(GC)(T)

Color and Shape: Colorless to Light yellow to Light orange clear liquid

Molecular weight: 172.58

Ref: 3B-F1116

4-fluoro-3-methylbenzoyl chloride

CAS: 455-84-5

Formula: C₈H₆ClFO

Purity: 98%

Color and Shape: Solid

Molecular weight: 172.5840

Ref: IN-DA003LEB

4-Fluoro-3-methylbenzoyl chloride

CAS: 455-84-5

4-Fluoro-3-methylbenzoyl chloride

Formula: C₈H₆ClFO

Purity: 97%

Color and Shape: hazy. light yellow liquid or light yellow low melting solid

Molecular weight: 172.58g/mol

Ref: 54-PC0350

4-Fluoro-3-methylbenzoyl chloride

CAS: 455-84-5

Formula: C₈H₆ClFO

Purity: 97.0%

Color and Shape: Liquid

Molecular weight: 172.58

Ref: 10-F005792

4-Fluoro-3-methylbenzoyl Chloride

Controlled Product

CAS: 455-84-5

Applications 4-Fluoro-3-Methylbenzoyl Chloride (cas# 455-84-5) is a useful research chemical.

Formula: C₈H₆OFCl

Color and Shape: Neat

Molecular weight: 172.58

Ref: TR-F600498