CAS 4550-68-9

N-(1-cyanocyclohexyl)acetamide

Description:

N-(1-cyanocyclohexyl)acetamide, with the CAS number 4550-68-9, is an organic compound characterized by its amide functional group and a cyanocyclohexyl substituent. This compound features a cyclohexane ring with a cyano group (–C≡N) attached to one of its carbon atoms, which contributes to its unique chemical properties. The presence of the acetamide group (–C(=O)NH2) indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds like N-(1-cyanocyclohexyl)acetamide may exhibit moderate polarity due to the combination of the polar amide and cyano groups, which can affect their interactions in biological systems and chemical reactions. Additionally, the structure suggests potential applications in pharmaceuticals or agrochemicals, where such compounds may serve as intermediates or active ingredients. Safety and handling considerations are essential, as with many organic compounds, to mitigate any risks associated with exposure or environmental impact.

Formula: C₉H₁₄N₂O

InChI: InChI=1/C9H14N2O/c1-8(12)11-9(7-10)5-3-2-4-6-9/h2-6H2,1H3,(H,11,12)

SMILES: CC(=NC1(CCCCC1)C#N)O

Synonyms:

• acetamide, N-(1-cyanocyclohexyl)-

N-(1-Cyanocyclohexyl)acetamide

CAS: 4550-68-9

Formula: C₉H₁₄N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 166.2203

Ref: IN-DA00DIHS

N-(1-Cyanocyclohexyl)acetamide

CAS: 4550-68-9

Versatile small molecule scaffold

Formula: C₉H₁₄N₂O

Purity: Min. 95%

Molecular weight: 166.22 g/mol

Ref: 3D-EAA55068