CAS 4550-72-5

1,3-bis(4-aminophenyl)urea

Description:

1,3-bis(4-aminophenyl)urea, also known as BAMU, is an organic compound characterized by its urea functional group and two para-aminophenyl substituents. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols. It exhibits significant thermal stability and can be used in various applications, including as a building block in organic synthesis and in the development of polymers. The presence of amino groups contributes to its reactivity, allowing for potential interactions in biological systems and materials science. Additionally, BAMU may exhibit properties such as antioxidant activity and has been studied for its potential use in pharmaceuticals and as a dye intermediate. Its molecular structure allows for hydrogen bonding, which can influence its solubility and interaction with other compounds. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₃H₁₄N₄O

InChI: InChI=1/C13H14N4O/c14-9-1-5-11(6-2-9)16-13(18)17-12-7-3-10(15)4-8-12/h1-8H,14-15H2,(H2,16,17,18)

SMILES: c1cc(ccc1N)NC(=O)Nc1ccc(cc1)N

1,3-Bis(4-aminophenyl)urea

CAS: 4550-72-5

Formula: C₁₃H₁₄N₄O

Purity: 95%

Color and Shape: Solid

Molecular weight: 242.2765

Ref: IN-DA00DH66

NSC 15364

CAS: 4550-72-5

NSC 15364

Purity: ≥95%

Molecular weight: 242.28g/mol

Ref: 54-BUP14464

NSC 15364

CAS: 4550-72-5

NSC 15364 (1,3-Bis(4-aminophenyl)urea) can be used for screening of ALR inhibitors by detection of hydrogen peroxide production Measured in Biochemical System.

Formula: C₁₃H₁₄N₄O

Purity: 98.67%

Color and Shape: Solid

Molecular weight: 242.28

Ref: TM-T3572

1,3-Bis(4-aminophenyl)urea

CAS: 4550-72-5

Formula: C₁₃H₁₄N₄O

Purity: 98%

Color and Shape: Solid

Molecular weight: 242.282

Ref: 10-F464144