CAS 4551-00-2

9-[3-(2-nitrophenyl)prop-2-en-1-ylidene]-9H-fluorene

Description:

9-[3-(2-Nitrophenyl)prop-2-en-1-ylidene]-9H-fluorene, with the CAS number 4551-00-2, is an organic compound characterized by its unique structure that includes a fluorene backbone and a substituted alkenyl group featuring a nitrophenyl moiety. This compound typically exhibits properties associated with both aromatic and alkenyl systems, such as stability and potential reactivity due to the presence of the nitro group, which can influence its electronic properties. The nitrophenyl group may impart polar characteristics, affecting solubility in various solvents. Additionally, the compound may display interesting photophysical properties, making it a candidate for applications in organic electronics or as a fluorescent probe. Its synthesis often involves multi-step organic reactions, and it may be studied for its potential biological activity or as a precursor in material science. Overall, the compound's unique structural features contribute to its chemical behavior and potential applications in various fields of research.

Formula: C₂₂H₁₅NO₂

InChI: InChI=1/C22H15NO2/c24-23(25)22-15-6-1-8-16(22)9-7-14-21-19-12-4-2-10-17(19)18-11-3-5-13-20(18)21/h1-15H

SMILES: c1ccc(c(c1)C=CC=C1c2ccccc2c2ccccc12)N(=O)=O

NSC-70220

CAS: 4551-00-2

NSC-70220 is a high purity, soluble synthetic peptide that is a potent activator of the human angiotensin II type 2 receptor (AT2R). It has been shown to activate AT2R in multiple cell types and tissues, including cultured cells and tissues from human, mouse, rat, and zebrafish. NSC-70220 has also been shown to be an inhibitor of protein interactions.

Formula: C₂₂H₁₅NO₂

Purity: Min. 95%

Molecular weight: 325.4 g/mol

Ref: 3D-EAA55100

NSC-70220

CAS: 4551-00-2

SOS1-IN-1 is an inhibitor of SOS1.

Formula: C₂₂H₁₅NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 325.36

Ref: TM-T12978