CAS 4551-00-2: 9-[3-(2-nitrophenyl)prop-2-en-1-ylidene]-9H-fluorene
Description:9-[3-(2-Nitrophenyl)prop-2-en-1-ylidene]-9H-fluorene, with the CAS number 4551-00-2, is an organic compound characterized by its unique structure that includes a fluorene backbone and a substituted alkenyl group featuring a nitrophenyl moiety. This compound typically exhibits properties associated with both aromatic and alkenyl systems, such as stability and potential reactivity due to the presence of the nitro group, which can influence its electronic properties. The nitrophenyl group may impart polar characteristics, affecting solubility in various solvents. Additionally, the compound may display interesting photophysical properties, making it a candidate for applications in organic electronics or as a fluorescent probe. Its synthesis often involves multi-step organic reactions, and it may be studied for its potential biological activity or as a precursor in material science. Overall, the compound's unique structural features contribute to its chemical behavior and potential applications in various fields of research.
Formula:C22H15NO2
InChI:InChI=1/C22H15NO2/c24-23(25)22-15-6-1-8-16(22)9-7-14-21-19-12-4-2-10-17(19)18-11-3-5-13-20(18)21/h1-15H
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | NSC-70220 REF: 3D-EAA55100CAS: 4551-00-2 | Min. 95% | 430.00 €~2,558.00 € | Thu 29 May 25 |
![]() | NSC-70220 REF: TM-T12978CAS: 4551-00-2 | 98% | 113.00 €~1,768.00 € | Thu 05 Jun 25 |

NSC-70220
Ref: 3D-EAA55100
5mg | 430.00 € | ||
10mg | 613.00 € | ||
25mg | 1,026.00 € | ||
50mg | 1,642.00 € | ||
100mg | 2,558.00 € |

NSC-70220
Ref: TM-T12978
2mg | 230.00 € | ||
5mg | 283.00 € | ||
25mg | 938.00 € | ||
50mg | 1,293.00 € | ||
100mg | 1,768.00 € |