CymitQuimica logo

CAS 45514-40-7

:

1,3-Dimethyl-2-imidazolidinimine

Description:
1,3-Dimethyl-2-imidazolidinimine is an organic compound characterized by its imidazolidinimine structure, which features a five-membered ring containing two nitrogen atoms and three carbon atoms. This compound is typically recognized for its role as a building block in organic synthesis and may exhibit properties such as being a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its potential applications in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. The presence of the dimethyl groups contributes to its steric and electronic properties, influencing its reactivity and interaction with other chemical species. Additionally, 1,3-Dimethyl-2-imidazolidinimine may exhibit moderate solubility in polar solvents, making it useful in diverse chemical environments. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C5H11N3
InChI:InChI=1S/C5H11N3/c1-7-3-4-8(2)5(7)6/h6H,3-4H2,1-2H3
InChI key:InChIKey=KSESOTWVQYBRLJ-UHFFFAOYSA-N
SMILES:N=C1N(C)CCN1C
Synonyms:
  • 1,3-Dimethyl-2-iminoimidazolidine
  • 1,3-Dimethyl-2-imidazolidinimine
  • 2-Imidazolidinimine, 1,3-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.