CAS 4552-43-6

4-chloroquinoline-2-carbonitrile

Description:

4-Chloroquinoline-2-carbonitrile is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. The presence of a chloro group at the 4-position and a cyano group at the 2-position contributes to its unique chemical properties. This compound typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to its bioactive properties. It may exhibit moderate to high solubility in organic solvents, while its solubility in water is generally low. The compound's reactivity can be influenced by the electron-withdrawing nature of the chloro and cyano groups, making it a useful intermediate in various chemical syntheses. Additionally, 4-chloroquinoline-2-carbonitrile may possess antimicrobial or antitumor activities, which are of interest in medicinal chemistry. Safety data should be consulted for handling, as it may pose health risks if ingested or inhaled.

Formula: C₁₀H₅ClN₂

InChI: InChI=1/C10H5ClN2/c11-9-5-7(6-12)13-10-4-2-1-3-8(9)10/h1-5H

SMILES: c1ccc2c(c1)c(cc(C#N)n2)Cl

Synonyms:

• 4-Chloro-2-cyanoquinoline

4-Chloroquinoline-2-carbonitrile

CAS: 4552-43-6

Formula: C₁₀H₅ClN₂

Purity: %

Color and Shape: Solid

Molecular weight: 188.6131

Ref: IN-DA006ZIV

4-Chloroquinoline-2-carbonitrile

CAS: 4552-43-6

4-Chloroquinoline-2-carbonitrile

Purity: 95+%

Ref: 54-OR1038824

4-Chloroquinoline-2-carbonitrile

CAS: 4552-43-6

Purity: 95+%

Molecular weight: 188.6100006

Ref: 10-F618929

4-Chloroquinoline-2-carbonitrile

CAS: 4552-43-6

4-Chloroquinoline-2-carbonitrile is a cytotoxic agent that inhibits the growth of cancer cells. It has been shown to be effective against a number of cancer cell lines, including those resistant to colchicine. 4-Chloroquinoline-2-carbonitrile binds to the colchicine binding site on the enzyme mitotic spindle and prevents the anchoring of microtubules at the centrosomes, inhibiting cell division and leading to apoptosis. This drug is structurally similar to colchicine, which is also an inhibitor of mitotic spindle assembly, but lacks its ability to bind covalently to DNA.

Formula: C₁₀H₅ClN₂

Purity: Min. 95%

Molecular weight: 188.61 g/mol

Ref: 3D-EAA55243