CAS 45521-09-3
:(S)-4-Thiazolidinecarboxylic acid
Description:
(S)-4-Thiazolidinecarboxylic acid is a chiral compound characterized by its thiazolidine ring structure, which contains a sulfur atom and a carboxylic acid functional group. This compound is notable for its role in various biochemical processes and potential applications in pharmaceuticals, particularly in the synthesis of amino acids and other biologically active molecules. The presence of the thiazolidine ring contributes to its unique stereochemistry, influencing its reactivity and interactions with biological systems. As a carboxylic acid, it exhibits typical acid-base properties, including the ability to donate protons in solution. Additionally, (S)-4-Thiazolidinecarboxylic acid may participate in various chemical reactions, such as esterification and amidation, making it a versatile building block in organic synthesis. Its solubility and stability can vary depending on the solvent and conditions, which is important for its practical applications. Overall, this compound is of interest in both synthetic organic chemistry and medicinal chemistry due to its structural features and potential biological activities.
Formula:C4H7NO2S
InChI:InChI=1S/C4H7NO2S/c6-4(7)3-1-8-2-5-3/h3,5H,1-2H2,(H,6,7)/t3-/m1/s1
InChI key:InChIKey=DZLNHFMRPBPULJ-GSVOUGTGSA-N
SMILES:C(O)(=O)[C@H]1CSCN1
Synonyms:- (4S)-1,3-thiazolidine-4-carboxylic acid
- (4S)-4-Thiazolidinecarboxylic acid
- (S)-4-Thiazolidinecarboxylic acid
- 4-Thiazolidinecarboxylic acid, (4S)-
- 4-Thiazolidinecarboxylic acid, (S)-
- 4-Thiazolidinecarboxylic acid, D-
- <span class="text-smallcaps">D</span>-Thiazolidine-4-carboxylic acid
- <span class="text-smallcaps">L</span>-4-Thioproline
- Acide D thiazolidine carboxylique-4
- Acide D thiazolidine carboxylique-4 [French]
- D-Thiazolidine-4-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Thiazolidinecarboxylic acid, (4S)-
CAS:Formula:C4H7NO2SPurity:95%Color and Shape:SolidMolecular weight:133.1689(S)-Thiazolidine-4-carboxylic acid
CAS:(S)-Thiazolidine-4-carboxylic acidPurity:98%Molecular weight:133.17g/molD-Thiaproline
CAS:<p>D-Thiaproline is a pro-inflammatory cytokine that belongs to the group of tnf-α. It has been shown to have depressant activity on mitochondria and can be used as a sample preparation agent. D-Thiaproline has also been shown to inhibit the uptake of various neurotransmitters, such as serotonin and dopamine, in rat brain synaptosomes. This compound also has functional groups, such as hydroxyl, carboxyl, and amino acid groups, which are necessary for reactions with other molecules. D-Thiaproline is an isomer of L-thiaproline and can be differentiated from this form by its protonated amine group at pH 7.0 and by its zwitterionic nature.</p>Formula:C4H7NO2SPurity:Min. 95%Color and Shape:PowderMolecular weight:133.2 g/mol(S)-Thiazolidine-4-carboxylic acid
CAS:Formula:C4H7NO2SPurity:97%Color and Shape:Solid, PowderMolecular weight:133.17Timonacic, (S)-
CAS:Timonacic, (S)- is a heterocyclic compound and the stereoisomer of Timonacic, suitable for biochemical experiments and drug synthesis research.Formula:C4H7NO2SPurity:98.06%Color and Shape:SolidMolecular weight:133.17




