CAS 455303-00-1

2,2'-{[(3,4-dihydroxy-9,10-dioxo-9,10-dihydroanthracen-2-yl)methyl]ammonio}diacetate

Description:

2,2'-{[(3,4-dihydroxy-9,10-dioxo-9,10-dihydroanthracen-2-yl)methyl]ammonio}diacetate is a complex organic compound characterized by its unique structure, which includes an anthracene derivative with hydroxyl and carbonyl functional groups. This compound features a quaternary ammonium moiety, contributing to its potential solubility in polar solvents. The presence of diacetate groups suggests that it can participate in various chemical reactions, including esterification and salt formation. The hydroxyl groups may enhance its reactivity and ability to form hydrogen bonds, potentially influencing its biological activity and interactions with other molecules. Given its structural components, this compound may exhibit interesting properties such as fluorescence, making it of interest in fields like materials science and medicinal chemistry. Its specific applications would depend on further studies regarding its stability, reactivity, and biological effects. Overall, the compound represents a fascinating intersection of organic chemistry and potential practical applications.

Formula: C₁₉H₁₄NO₈

InChI: InChI=1/C19H15NO8/c21-13(22)7-20(8-14(23)24)6-9-5-12-15(19(28)16(9)25)18(27)11-4-2-1-3-10(11)17(12)26/h1-5,25,28H,6-8H2,(H,21,22)(H,23,24)/p-1

SMILES: c1ccc2c(c1)C(=O)c1cc(CN(CC(=O)[O-])CC(=O)O)c(c(c1C2=O)O)O

ALIZARIN COMPLEXONE DIHYDRATE, INDICATOR GRADE, PURE

CAS: 455303-00-1

Formula: C₁₉H₁₉NO₁₀

Purity: 97%

Color and Shape: Solid

Molecular weight: 421.3549

Ref: IN-DA00DENT

Alizarin complexone dihydrate

CAS: 455303-00-1

Alizarin complexone dihydrate reacts with Lanthanum or Cesium(III) ions to form a red chelate, which, in turn, reacts with fluoride ions to give a blue ternary complex (Alizarin Fluorine Blue); to detect fluoride.

Formula: C₁₉H₁₅NO₈·2H₂O

Color and Shape: Powder

Molecular weight: 421.35 g/mol

Ref: 3D-FA01404