CymitQuimica logo

CAS 4565-31-5

:

5-Formyl-2-thiophenecarboxylic Acid

Description:
5-Formyl-2-thiophenecarboxylic acid is an organic compound characterized by the presence of both a formyl group (-CHO) and a carboxylic acid group (-COOH) attached to a thiophene ring. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar solvents such as water and alcohols, owing to its functional groups. The presence of the thiophene ring contributes to its aromatic properties, which can influence its reactivity and stability. The compound is often utilized in organic synthesis, particularly in the preparation of various derivatives and in the development of pharmaceuticals and agrochemicals. Its reactivity can be attributed to the electrophilic nature of the formyl group, making it a useful intermediate in various chemical reactions. Additionally, the compound may exhibit interesting biological activities, although specific studies would be required to elucidate its potential applications in medicinal chemistry. Overall, 5-Formyl-2-thiophenecarboxylic acid is a versatile building block in organic synthesis with potential implications in various fields.
Formula:C6H3O3S
InChI:InChI=1/C6H4O3S/c7-3-4-1-2-5(10-4)6(8)9/h1-3H,(H,8,9)/p-1
InChI key:VFEAMMGYJFFXKV-UHFFFAOYSA-N
SMILES:c1cc(C(=O)[O-])sc1C=O
Synonyms:
  • 3-(1-methyl-1H-benzimidazol-2-yl)-2-oxo-2H-chromen-7-yl propanoate
  • 5-Formylthiophene-2-Carboxylic Acid
  • 5-Formylthiophene-2-Carboxylate
Found 5 products.