CAS 45676-69-5
:5-Methyloxazole-2-carboxylic acid
Description:
5-Methyloxazole-2-carboxylic acid is an organic compound characterized by its oxazole ring structure, which is a five-membered heterocycle containing both nitrogen and oxygen atoms. This compound features a methyl group at the 5-position and a carboxylic acid functional group at the 2-position, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents, reflecting its ability to engage in hydrogen bonding due to the presence of the carboxylic acid group. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activities. Its molecular structure allows for various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the presence of the oxazole ring may impart unique electronic properties, influencing its reactivity and interactions with other molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H5NO3
InChI:InChI=1/C5H5NO3/c1-3-2-6-4(9-3)5(7)8/h2H,1H3,(H,7,8)
SMILES:Cc1cnc(C(=O)O)o1
Synonyms:- 2-Oxazolecarboxylic Acid, 5-Methyl-
- 5-Methyl-1,3-oxazole-2-carboxylic acid
- 5-methyl-2-oxazolecarboxylic acid
- 5-METHYLOXAZOLE-2-CARBOXYLIC ACID
- 2-Oxazolecarboxylicacid, 5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
