CAS 457061-31-3

2-fluoro-4-(tributylstannanyl)pyridine

Description:

2-Fluoro-4-(tributylstannanyl)pyridine is an organometallic compound characterized by the presence of a pyridine ring substituted with a fluorine atom and a tributylstannyl group. The molecular structure features a pyridine moiety, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its basicity and potential reactivity in various chemical reactions. The tributylstannyl group, derived from tributyltin, introduces significant steric bulk and can enhance the compound's lipophilicity, making it useful in organic synthesis and materials science. This compound may exhibit unique properties such as increased stability and reactivity due to the presence of the tin atom, which can participate in various organometallic reactions. Additionally, the fluorine atom can influence the electronic properties of the molecule, potentially affecting its reactivity and interactions with other chemical species. Overall, 2-fluoro-4-(tributylstannanyl)pyridine is of interest in fields such as medicinal chemistry, materials science, and organometallic chemistry due to its distinctive structural features and potential applications.

Formula: C₁₇H₃₀FNSn

InChI: InChI=1/C5H3FN.3C4H9.Sn/c6-5-3-1-2-4-7-5;3*1-3-4-2;/h2-4H;3*1,3-4H2,2H3;/rC17H30FNSn/c1-4-7-12-20(13-8-5-2,14-9-6-3)16-10-11-19-17(18)15-16/h10-11,15H,4-9,12-14H2,1-3H3

SMILES: CCCC[Sn](CCCC)(CCCC)c1ccnc(c1)F

Synonyms:

• 2-Fluoro-4-(tributylstannyl)pyridine
• Pyridine, 2-fluoro-4-(tributylstannyl)-

2-Fluoro-4-(tributylstannyl)pyridine

CAS: 457061-31-3

2-Fluoro-4-(tributylstannyl)pyridine

Purity: ≥95%

Color and Shape: Liquid

Molecular weight: 386.14g/mol

Ref: 54-PC8518

2-Fluoro-4-(tributylstannyl)pyridine

Controlled Product

CAS: 457061-31-3

Please enquire for more information about 2-Fluoro-4-(tributylstannyl)pyridine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₇H₃₀FNSn

Purity: Min. 95%

Molecular weight: 386.14 g/mol

Ref: 3D-FF83169