CAS 457097-75-5

(3R)-1-methylpyrrolidin-3-amine

Description:

(3R)-1-methylpyrrolidin-3-amine, with the CAS number 457097-75-5, is an organic compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The "1-methyl" designation indicates the presence of a methyl group attached to the nitrogen atom at the first position of the ring, while the "3-amine" indicates an amino group (-NH2) at the third carbon of the pyrrolidine ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in water and various organic solvents, making it versatile for use in chemical synthesis and pharmaceutical applications. The chirality at the 3-position (denoted by (3R)) suggests that it has specific stereochemical properties, which can influence its biological activity and interactions with other molecules. As a building block in medicinal chemistry, it may be involved in the synthesis of various pharmaceuticals, particularly those targeting neurological or psychiatric conditions.

Formula: C₅H₁₂N₂

InChI: InChI=1/C5H12N2/c1-7-3-2-5(6)4-7/h5H,2-4,6H2,1H3/t5-/m1/s1

SMILES: CN1CC[C@H](C1)N

(R)-1-Methylpyrrolidin-3-amine

CAS: 457097-75-5

Formula: C₅H₁₂N₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 100.1622

Ref: IN-DA003A62

(3R)-3-Amino-1-methylpyrrolidine

CAS: 457097-75-5

(3R)-3-Amino-1-methylpyrrolidine

Purity: ≥95%

Color and Shape: Colourless - Yellow Liquid

Molecular weight: 100.16g/mol

Ref: 54-OR308141

(R)-1-Methyl-pyrrolidin-3-ylamine

CAS: 457097-75-5

Formula: C₅H₁₂N₂

Purity: 97%

Color and Shape: Liquid, Oil

Molecular weight: 100.165

Ref: 10-F087845