CAS 45715-08-0
:1-(5-methylpyridin-2-yl)methanamine
Description:
1-(5-Methylpyridin-2-yl)methanamine, with the CAS number 45715-08-0, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methanamine group attached to the pyridine, specifically at the 2-position, and a methyl group at the 5-position of the pyridine ring. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the amine functional group suggests that it can participate in hydrogen bonding, influencing its solubility in polar solvents. This compound may exhibit basic properties due to the nitrogen atom in the amine group, allowing it to act as a nucleophile in various chemical reactions. Additionally, it may have applications in pharmaceuticals or as an intermediate in organic synthesis, given the reactivity of both the amine and the aromatic ring. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H10N2
InChI:InChI=1/C7H10N2/c1-6-2-3-7(4-8)9-5-6/h2-3,5H,4,8H2,1H3
SMILES:Cc1ccc(CN)nc1
Synonyms:- (5-Methylpyridin-2-Yl)Methanamine
- (5-Methylpyridin-2-Yl)Methylamine
- 2-Pyridinemethanamine, 5-Methyl-
- 1-(5-Methylpyridin-2-yl)methanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(5-Methylpyridin-2-yl)methanamine
CAS:Formula:C7H10N2Purity:95%Color and Shape:SolidMolecular weight:122.1677(5-Methylpyridin-2-yl)methanamine
CAS:(5-Methylpyridin-2-yl)methanamineFormula:C7H10N2Purity:≥95%Color and Shape: pale-yellow liquidMolecular weight:122.17g/mol(5-Methylpyridin-2-yl)methanamine
CAS:5-Methylpyridin-2-yl)methanamine is a high quality reagent that is used as a building block in the synthesis of complex compounds. It can be used as an intermediate, useful for the preparation of fine chemicals and useful scaffolds. It can also be used as a speciality chemical and is often used as a reaction component in research chemicals.
Formula:C7H10N2Purity:Min. 98 Area-%Color and Shape:Clear LiquidMolecular weight:122.17 g/mol(5-Methylpyridin-2-yl)methylamine
CAS:Formula:C7H10N2Purity:95%Color and Shape:LiquidMolecular weight:122.171



