CymitQuimica logo

CAS 4576-56-1

:

Tris(4-chlorophenyl)phosphine oxide

Description:
Tris(4-chlorophenyl)phosphine oxide, with the CAS number 4576-56-1, is an organophosphorus compound characterized by its three 4-chlorophenyl groups attached to a central phosphorus atom, which is also bonded to an oxygen atom, forming a phosphine oxide. This compound typically appears as a white to off-white solid and is known for its stability and relatively low volatility. It exhibits good solubility in organic solvents such as dichloromethane and chloroform, making it useful in various chemical applications. Tris(4-chlorophenyl)phosphine oxide is often employed as a ligand in coordination chemistry and catalysis, as well as in the synthesis of other phosphorus-containing compounds. Its chlorinated phenyl groups contribute to its electronic properties, enhancing its reactivity in certain chemical reactions. Additionally, this compound may exhibit biological activity, although specific interactions and effects would depend on the context of its use. As with many organophosphorus compounds, proper handling and safety precautions are essential due to potential toxicity.
Formula:C18H12Cl3OP
InChI:InChI=1S/C18H12Cl3OP/c19-13-1-7-16(8-2-13)23(22,17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H
InChI key:InChIKey=GJBIMMKVOGMMLP-UHFFFAOYSA-N
SMILES:P(=O)(C1=CC=C(Cl)C=C1)(C2=CC=C(Cl)C=C2)C3=CC=C(Cl)C=C3
Synonyms:
  • NSC 10066
  • Phosphine oxide, tris(4-chlorophenyl)-
  • Phosphine oxide, tris(p-chlorophenyl)-
  • Tri(p-chlorophenyl)phosphine monoxide
  • Tris(4-chlorophenyl)phosphine oxide
  • Tris(p-chlorophenyl)phosphine oxide
Found 4 products.