CAS 4576-90-3

3-Isothiazolecarboxylic acid

Description:

3-Isothiazolecarboxylic acid is a heterocyclic organic compound characterized by the presence of both an isothiazole ring and a carboxylic acid functional group. The isothiazole ring consists of a five-membered structure containing both sulfur and nitrogen atoms, which contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. It is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, owing to its biological activity and ability to act as a building block in synthetic chemistry. The compound may also exhibit antimicrobial properties, making it of interest in the development of new antimicrobial agents. Additionally, its reactivity can be influenced by the functional groups attached to the isothiazole ring, allowing for further derivatization and modification in chemical synthesis. Overall, 3-Isothiazolecarboxylic acid is a versatile compound with significant implications in both research and industrial applications.

Formula: C₄H₃NO₂S

InChI: InChI=1/C4H3NO2S/c6-4(7)3-1-2-8-5-3/h1-2H,(H,6,7)

SMILES: c1csnc1C(=O)O

Synonyms:

• Isothiazole-3-carboxylic acid
• 1,2-Thiazole-3-Carboxylic Acid

Isothiazole-3-carboxylic acid

CAS: 4576-90-3

Formula: C₄H₃NO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 129.1371

Ref: IN-DA006YSP

Isothiazole-3-carboxylic acid

CAS: 4576-90-3

Purity: 95%

Molecular weight: 129.137

Ref: FT-I13225

Isothiazole-3-carboxylic acid

CAS: 4576-90-3

Isothiazole-3-carboxylic acid

Formula: C₄H₃NO₂S

Purity: 95%

Color and Shape: beige solid

Molecular weight: 129.14g/mol

Ref: 54-OR40803

Isothiazole-3-carboxylic acid

CAS: 4576-90-3

Formula: C₄H₃NO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 129.13

Ref: 10-F236968

Isothiazole-3-carboxylicacid

CAS: 4576-90-3

Isothiazole-3-carboxylicacid is a nitro compound that is found in biocides, such as insecticides and fungicides. It reacts with nucleophiles by undergoing nucleophilic attack to form an amide. This reaction scheme can be seen when the nitro group reacts with water to form an amide. The nervous system diseases are thought to be caused by the inhibition of neurotransmitter release at nerve synapses by blocking the ion channels that transport sodium ions into cells.

Formula: C₄H₃NO₂S

Purity: Min. 95%

Molecular weight: 129.14 g/mol

Ref: 3D-FI146937