CAS 457654-55-6

Phenylalanine, 3-chloro-, ethyl ester, hydrochloride

Description:

Phenylalanine, 3-chloro-, ethyl ester, hydrochloride is a chemical compound characterized by its structure, which includes a phenylalanine backbone modified with a chlorine atom at the 3-position and an ethyl ester functional group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it more stable for various applications. It is often used in biochemical research and pharmaceutical development due to its potential role in synthesizing other compounds or as a building block in peptide synthesis. The presence of the chlorine atom can influence the compound's reactivity and biological activity, making it of interest in medicinal chemistry. As with many amino acid derivatives, it may exhibit properties such as being a chiral molecule, which can affect its interactions in biological systems. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₁₄ClNO₂·ClH

InChI: InChI=1S/C11H14ClNO2.ClH/c1-2-15-11(14)10(13)7-8-4-3-5-9(12)6-8;/h3-6,10H,2,7,13H2,1H3;1H

InChI key: InChIKey=HNZGZHRWNCDKDH-UHFFFAOYSA-N

SMILES: C(C(C(OCC)=O)N)C1=CC(Cl)=CC=C1.Cl

Synonyms:

• Phenylalanine, 3-chloro-, ethyl ester, hydrochloride

Ethyl 2-amino-3-(3-chlorophenyl)propanoate hydrochloride

CAS: 457654-55-6

Versatile small molecule scaffold

Formula: C₁₁H₁₅Cl₂NO₂

Purity: Min. 95%

Molecular weight: 264.14 g/mol

Ref: 3D-HTA65455