CAS 457889-46-2

[4'-(trifluoromethyl)biphenyl-4-yl]methanol

Description:

[4'-(Trifluoromethyl)biphenyl-4-yl]methanol, with the CAS number 457889-46-2, is an organic compound characterized by the presence of a biphenyl structure substituted with a trifluoromethyl group and a hydroxymethyl group. The trifluoromethyl group (-CF3) is known for its electron-withdrawing properties, which can significantly influence the compound's reactivity and stability. The biphenyl moiety contributes to the compound's hydrophobic characteristics, while the hydroxymethyl (-CH2OH) group introduces a polar functional group, enhancing solubility in polar solvents. This compound may exhibit interesting properties such as potential applications in pharmaceuticals, agrochemicals, or materials science due to its unique electronic and steric properties. Additionally, the presence of fluorine atoms can impart distinctive characteristics, such as increased lipophilicity and altered biological activity. Overall, [4'-(trifluoromethyl)biphenyl-4-yl]methanol is a versatile compound with potential utility in various chemical applications.

Formula: C₁₄H₁₁F₃O

InChI: InChI=1/C14H11F3O/c15-14(16,17)13-7-5-12(6-8-13)11-3-1-10(9-18)2-4-11/h1-8,18H,9H2

SMILES: c1cc(ccc1CO)c1ccc(cc1)C(F)(F)F

Synonyms:

• (4'-Trifluoromethylbiphenyl-4-yl)methanol
• [1,1'-Biphenyl]-4-methanol, 4'-(trifluoromethyl)-
• 4-[4-(Trifluoromethyl)phenyl]benzyl alcohol
• Q1R Dr Dxfff
• [4'-(Trifluoromethyl)biphenyl-4-yl]methanol

(4'-TRIFLUOROMETHYLBIPHENYL-4-YL)-METHANOL

CAS: 457889-46-2

Formula: C₁₄H₁₁F₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 252.2317

Ref: IN-DA00DEBG

4'-(Trifluoromethyl)[1,1'-biphenyl]-4-methanol

CAS: 457889-46-2

4'-(Trifluoromethyl)[1,1'-biphenyl]-4-methanol

Purity: 98%

Molecular weight: 252.23g/mol

Ref: 54-PC103552

[4′-(Trifluoromethyl)[1,1′-biphenyl]-4-yl]methanol

CAS: 457889-46-2

Formula: C₁₄H₁₁F₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 252.236

Ref: 10-F041778