CAS 458-52-6
:4-Methoxy-2-fluoroaniline
Description:
4-Methoxy-2-fluoroaniline, with the CAS number 458-52-6, is an aromatic amine characterized by the presence of a methoxy group (-OCH₃) and a fluoro group (-F) attached to a benzene ring. The methoxy group is located at the para position relative to the amino group (-NH₂), while the fluoro group is positioned at the ortho position. This compound typically appears as a solid or liquid, depending on the temperature and purity. It is known for its potential applications in the synthesis of pharmaceuticals, agrochemicals, and dyes due to its reactivity and ability to undergo various chemical transformations. The presence of both electron-donating (methoxy) and electron-withdrawing (fluoro) groups influences its electronic properties, making it a useful intermediate in organic synthesis. Additionally, 4-Methoxy-2-fluoroaniline may exhibit specific solubility characteristics in organic solvents and can participate in electrophilic aromatic substitution reactions, further expanding its utility in chemical research and industry. Safety precautions should be observed when handling this compound, as with many amines and halogenated substances.
Formula:C7H8FNO
InChI:InChI=1/C7H8FNO/c1-10-5-2-3-7(9)6(8)4-5/h2-4H,9H2,1H3
SMILES:COc1ccc(c(c1)F)N
Synonyms:- 2-Fluoro-4-methoxyaniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenamine, 2-fluoro-4-methoxy-
CAS:Formula:C7H8FNOPurity:96%Color and Shape:SolidMolecular weight:141.14292-Fluoro-4-methoxyaniline
CAS:2-Fluoro-4-methoxyanilineFormula:C7H8FNOPurity:98%Color and Shape:White PowderMolecular weight:141.14g/mol2-Fluoro-4-methoxyaniline
CAS:2-Fluoro-4-methoxyaniline is a non-selective amide that forms in the presence of amines, aminobutyraldehyde, and fluorine. 2-Fluoro-4-methoxyaniline is a product of the industrial process for synthesizing acetylated products through the use of dichloroketene as an acetylating agent. This chemical compound has been used to produce five-membered heterocycles that are used in the manufacture of pharmaceuticals. Mechanistic studies have shown that this chemical reacts with oxygen, water, and halogens to form a variety of products.Formula:C7H8FNOPurity:Min. 95%Color and Shape:Yellow PowderMolecular weight:141.14 g/mol



