CAS 45811-94-7
:(4-bromobenzyl)hydrazine
Description:
(4-Bromobenzyl)hydrazine is an organic compound characterized by the presence of a hydrazine functional group attached to a bromobenzyl moiety. Its molecular structure features a benzene ring substituted with a bromine atom at the para position relative to the hydrazine group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity, particularly in forming hydrazones and other derivatives through condensation reactions with carbonyl compounds. The presence of the bromine atom enhances its electrophilic character, making it useful in various synthetic applications, including medicinal chemistry and material science. Additionally, (4-bromobenzyl)hydrazine may exhibit biological activity, which warrants careful handling due to potential toxicity. As with many hydrazine derivatives, it is important to consider safety protocols when working with this compound, as it can be hazardous. Overall, (4-bromobenzyl)hydrazine serves as a valuable intermediate in organic synthesis and research.
Formula:C7H9BrN2
InChI:InChI=1/C7H9BrN2/c8-7-3-1-6(2-4-7)5-10-9/h1-4,10H,5,9H2
SMILES:c1cc(ccc1CNN)Br
Synonyms:- 4-BroMobenzylhydrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.


