CAS 45813-02-3

1-methyl-4-(prop-2-yn-1-yl)piperazine

Description:

1-Methyl-4-(prop-2-yn-1-yl)piperazine is an organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a methyl group at the first position and a prop-2-yn-1-yl substituent at the fourth position of the piperazine ring. The presence of the alkyne group (prop-2-yn-1-yl) contributes to its reactivity, making it a potential candidate for various chemical reactions, including those involving nucleophiles or electrophiles. The compound is typically colorless to pale yellow and may exhibit a distinct odor. It is soluble in organic solvents, which is common for many piperazine derivatives. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with piperazine derivatives. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₈H₁₄N₂

InChI: InChI=1/C8H14N2/c1-3-4-10-7-5-9(2)6-8-10/h1H,4-8H2,2H3

SMILES: C#CCN1CCN(C)CC1

Synonyms:

• 1-Methyl-4-prop-2-ynyl-piperazine
• 45813-02-3

1-Methyl-4-prop-2-ynyl-piperazine

CAS: 45813-02-3

Formula: C₈H₁₄N₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 138.2102

Ref: IN-DA006YOW

1-Methyl-4-(prop-2-yn-1-yl)piperazine

CAS: 45813-02-3

1-Methyl-4-(prop-2-yn-1-yl)piperazine

Purity: 98%

Molecular weight: 138.21g/mol

Ref: 54-OR76493

1-Methyl-4-(prop-2-yn-1-yl)piperazine

CAS: 45813-02-3

Purity: 98%

Color and Shape: Liquid

Molecular weight: 138.2140045

Ref: 10-F671102