CAS 4582-18-7
:rel-(1R,2R,3R,4S)-N2,N2,N3,N3-Tetraethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide
Description:
The chemical substance known as rel-(1R,2R,3R,4S)-N2,N2,N3,N3-Tetraethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide, with the CAS number 4582-18-7, is a bicyclic compound characterized by its unique bicyclo[2.2.1]heptane structure. This compound features a complex arrangement of functional groups, including two carboxamide moieties and four ethyl substituents, which contribute to its chemical reactivity and potential applications. The stereochemistry indicated by the rel- and R/S designations suggests specific spatial arrangements of the atoms, which can influence the compound's biological activity and interaction with other molecules. Generally, compounds of this nature may exhibit properties such as solubility in organic solvents, potential for hydrogen bonding due to the amide groups, and the ability to participate in various chemical reactions. The presence of multiple functional groups also suggests that this compound could be of interest in medicinal chemistry or materials science, although specific applications would depend on further research and characterization.
Formula:C17H28N2O2
InChI:InChI=1/C17H28N2O2/c1-5-18(6-2)16(20)14-12-9-10-13(11-12)15(14)17(21)19(7-3)8-4/h9-10,12-15H,5-8,11H2,1-4H3/t12-,13+,14-,15-/s2
InChI key:InChIKey=BXAMVNHBXFXFSK-WHYCVVOHNA-N
SMILES:C(N(CC)CC)(=O)[C@H]1[C@H](C(N(CC)CC)=O)[C@@]2(C[C@]1(C=C2)[H])[H]
Synonyms:- rel-(1R,2R,3R,4S)-N2,N2,N3,N3-Tetraethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide
- Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide, N,N,N′,N′-tetraethyl-, (2-endo,3-exo)-
- 5-Norbornene-2,3-dicarboxamide, N,N,N′,N′-tetraethyl-, trans-
- Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide, N2,N2,N3,N3-tetraethyl-, (1R,2R,3R,4S)-rel-
- Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide, N,N,N′,N′-tetraethyl-, (1R,2R,3R,4S)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
