CymitQuimica logo

CAS 458532-84-8

:

2-Chloropyridine-4-boronic acid pinacol ester

Description:
2-Chloropyridine-4-boronic acid pinacol ester is an organoboron compound characterized by the presence of a boronic acid functional group and a chlorinated pyridine ring. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and ethanol. It is often used in organic synthesis, particularly in cross-coupling reactions, due to its ability to participate in Suzuki-Miyaura reactions, which are valuable for forming carbon-carbon bonds. The pinacol ester moiety enhances the stability and reactivity of the boronic acid, making it easier to handle and store. Additionally, the presence of the chlorine atom on the pyridine ring can influence the electronic properties and reactivity of the compound, allowing for further functionalization. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested. Overall, 2-Chloropyridine-4-boronic acid pinacol ester is a versatile reagent in synthetic organic chemistry.
Formula:C11H15BClNO2
InChI:InChI=1/C11H15BClNO2/c1-10(2)11(3,4)16-12(15-10)8-5-6-14-9(13)7-8/h5-7H,1-4H3
InChI key:UUEQDBHKMOFLDP-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2ccnc(c2)Cl)O1
Synonyms:
  • 2-Chloro-4-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Pyridine
  • 2-chloro-4-(tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine
Found 5 products.