CymitQuimica logo

CAS 458532-88-2

:

3-Fluoropyridine-4-boronic acid pinacol ester

Description:
3-Fluoropyridine-4-boronic acid pinacol ester is an organoboron compound characterized by the presence of a boronic acid functional group and a fluorinated pyridine ring. This compound typically exhibits a white to off-white solid appearance and is soluble in common organic solvents such as dichloromethane and ethanol. The boronic acid moiety is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including Suzuki-Miyaura cross-coupling reactions in organic synthesis. The presence of the fluorine atom in the pyridine ring can influence the electronic properties and reactivity of the compound, potentially enhancing its utility in medicinal chemistry and material science. Additionally, the pinacol ester formation provides stability and facilitates handling, while also allowing for further functionalization. As with many organoboron compounds, care should be taken when handling due to potential reactivity and the need for appropriate safety measures.
Formula:C11H15BFNO2
InChI:InChI=1S/C11H15BFNO2/c1-10(2)11(3,4)16-12(15-10)8-5-6-14-7-9(8)13/h5-7H,1-4H3
InChI key:InChIKey=MLFGHAHGSVFKMI-UHFFFAOYSA-N
SMILES:FC=1C(B2OC(C)(C)C(C)(C)O2)=CC=NC1
Synonyms:
  • 2-(3-Fluoropyridin-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
  • 3-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
  • 3-Fluoro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
  • Pyridine, 3-Fluoro-4-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)-
  • 3-Fluoropyridine-4-boronic acid pinacol ester
Found 4 products.