CAS 458532-94-0
:2-Bromopyridine-4-boronic acid
Description:
2-Bromopyridine-4-boronic acid is an organoboron compound characterized by the presence of both a bromine atom and a boronic acid functional group attached to a pyridine ring. Its molecular structure features a pyridine ring substituted at the 2-position with a bromine atom and at the 4-position with a boronic acid group, which is known for its ability to form reversible covalent bonds with diols. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions for the formation of carbon-carbon bonds. The boronic acid functionality allows it to act as a versatile building block in organic synthesis, especially in the development of pharmaceuticals and agrochemicals. Additionally, 2-Bromopyridine-4-boronic acid may exhibit biological activity, making it of interest in medicinal chemistry. Proper handling and storage are essential due to its reactivity and potential hazards associated with bromine-containing compounds.
Formula:C5H5BBrNO2
InChI:InChI=1/C5H5BBrNO2/c7-5-3-4(6(9)10)1-2-8-5/h1-3,9-10H
SMILES:c1cnc(cc1B(O)O)Br
Synonyms:- (2-Bromopyridin-4-yl)boronic acid
- boronic acid, B-(2-bromo-4-pyridinyl)-
- 2-Bromopyridin-4-Ylboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromopyridine-4-boronic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C5H5BBrNO2Purity:95%Color and Shape:White, powderMolecular weight:201.81(2-Bromopyridin-4-yl)boronic acid
CAS:Formula:C5H5BBrNO2Purity:98%Color and Shape:SolidMolecular weight:201.81372-Bromopyridin-4-ylboronic acid
CAS:2-Bromopyridin-4-ylboronic acidPurity:96%Color and Shape:Off-White SolidMolecular weight:201.81g/mol2-Bromopyridine-4-boronic acid
CAS:Formula:C5H5BBrNO2Purity:98%Color and Shape:SolidMolecular weight:201.81



