CAS 45889-43-8

1-(2-Hydroxyethyl)-eta-caprolactam

Description:

1-(2-Hydroxyethyl)-eta-caprolactam, with the CAS number 45889-43-8, is a chemical compound that belongs to the class of lactams, specifically a substituted caprolactam. This compound features a hydroxyl group (-OH) attached to a 2-hydroxyethyl side chain, which contributes to its hydrophilic properties. It is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. The presence of the hydroxyl group enhances its solubility in polar solvents, making it useful in various applications, including as a monomer in polymer synthesis and as an intermediate in the production of specialty chemicals. Additionally, its structure allows for potential interactions with other functional groups, which can be advantageous in chemical reactions. The compound may exhibit moderate toxicity, and appropriate safety measures should be taken when handling it. Overall, 1-(2-Hydroxyethyl)-eta-caprolactam is valued for its versatility in chemical synthesis and material science.

Formula: C₈H₁₅NO₂

InChI: InChI=1/C8H15NO2/c10-7-6-9-5-3-1-2-4-8(9)11/h10H,1-7H2

SMILES: C1CCC(=O)N(CC1)CCO

Synonyms:

• 1-(2-Hydroxyethyl)Azepan-2-One

1-(2-Hydroxyethyl)azepan-2-one

CAS: 45889-43-8

1-(2-Hydroxyethyl)azepan-2-one is a neutralizing reaction product of melamine and an amine. It is used as a corrosion inhibitor for coatings and in the production of aziridines, which are monomers that can be converted to amides or aldehydes. 1-(2-Hydroxyethyl)azepan-2-one is also used as an organic solvent.

Formula: C₈H₁₅NO₂

Purity: Min. 95%

Molecular weight: 157.21 g/mol

Ref: 3D-VBA88943