CAS 4589-12-2

N-(pyridin-2-yl)benzamide

Description:

N-(pyridin-2-yl)benzamide, with the CAS number 4589-12-2, is an organic compound characterized by the presence of both a pyridine and a benzamide functional group. This compound features a pyridine ring substituted at the 2-position with a benzamide moiety, which contributes to its unique chemical properties. It typically appears as a solid at room temperature and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and ethanol, but may have limited solubility in water. The presence of the nitrogen atom in the pyridine ring can impart basicity, while the amide group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. N-(pyridin-2-yl)benzamide may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features allow for potential applications in various fields, including pharmaceuticals and agrochemicals, where it may serve as a scaffold for the design of new compounds with desired biological properties.

Formula: C₁₂H₁₀N₂O

InChI: InChI=1/C12H10N2O/c15-12(10-6-2-1-3-7-10)14-11-8-4-5-9-13-11/h1-9H,(H,13,14,15)

SMILES: c1ccc(cc1)C(=Nc1ccccn1)O

Synonyms:

• benzamide, N-2-pyridinyl-
• N-(Pyridin-2-yl)benzamide

N-(2-Pyridyl)benzamide

CAS: 4589-12-2

Formula: C₁₂H₁₀N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.2206

Ref: IN-DA01C3LK

N-(2-Pyridyl)benzamide

CAS: 4589-12-2

N-(2-Pyridyl)benzamide

Formula: C₁₂H₁₀N₂O

Purity: ≥95%

Color and Shape: yellow crystalline powder

Molecular weight: 198.22g/mol

Ref: 54-OR49047

n-(Pyridin-2-yl)benzamide

CAS: 4589-12-2

Purity: ≥95%

Molecular weight: 198.2250061

Ref: 10-F658509

N-(Pyridin-2-yl)benzamide

CAS: 4589-12-2

Formula: C₁₂H₁₀N₂O

Molecular weight: 198.23

Ref: ST-EA-CP-A165045