CAS 459-05-2
:N-(4-Fluorophenyl)thiourea
Description:
N-(4-Fluorophenyl)thiourea is an organic compound characterized by the presence of a thiourea functional group attached to a para-fluorophenyl moiety. Its molecular structure features a thiourea group, which consists of a carbon atom double-bonded to a sulfur atom and single-bonded to two nitrogen atoms, one of which is connected to a phenyl ring substituted with a fluorine atom at the para position. This compound typically appears as a white to off-white solid and is known for its moderate solubility in polar solvents. N-(4-Fluorophenyl)thiourea exhibits properties that make it of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and ability to participate in various chemical reactions. It may also serve as a building block in the synthesis of other compounds. Safety data indicates that, like many thioureas, it should be handled with care due to potential toxicity and irritant properties. Proper safety protocols should be followed when working with this substance.
Formula:C7H7FN2S
InChI:InChI=1S/C7H7FN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11)
InChI key:InChIKey=BRWKXKNZRVALNZ-UHFFFAOYSA-N
SMILES:N(C(N)=S)C1=CC=C(F)C=C1
Synonyms:- (4-Fluorophenyl)thiourea
- 1-(4-Fluorophenyl)Thiourea
- 4-Fluorophenylthiourea
- N-(4-Fluorophenyl)thiourea
- Thiourea, (4-fluorophenyl)-
- Thiourea, N-(4-fluorophenyl)-
- Urea, 1-(p-fluorophenyl)-2-thio-
- p-Fluorophenylthiourea
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(4-Fluorophenyl)thiourea
CAS:Formula:C7H7FN2SPurity:>97.0%(HPLC)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:170.211-(4-Fluorophenyl)thiourea
CAS:Formula:C7H7FN2SPurity:97%Color and Shape:SolidMolecular weight:170.20734-Fluorophenylthiourea
CAS:4-FluorophenylthioureaFormula:C7H7FN2SPurity:98%Color and Shape: white crystalsMolecular weight:170.21g/mol1-(4-Fluorophenyl)-2-thiourea
CAS:Formula:C7H7FN2SPurity:95%Color and Shape:SolidMolecular weight:170.21N-(4-Fluorophenyl)thiourea
CAS:N-(4-Fluorophenyl)thiourea (FPTU) is a molecule that belongs to the class of thioureas. It has been shown to have a constant dihedral angle and is membrane transportable, which may be due to its ability to bind receptor proteins. FPTU has also been shown to inhibit chloride ion transport through the intestinal wall. In addition, it has been shown to have anti-inflammatory properties in animal models, which may be due to its ability to inhibit γ-aminobutyric acid (GABA) synthesis.
Formula:C7H7FN2SPurity:Min. 95%Molecular weight:170.21 g/mol




