CAS 459-23-4
:4-Fluorobenzaldehyde oxime
Description:
4-Fluorobenzaldehyde oxime, with the CAS number 459-23-4, is an organic compound characterized by the presence of both a fluorine atom and an oxime functional group attached to a benzaldehyde structure. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It has a molecular formula that reflects its aromatic nature, incorporating a benzene ring with a fluorine substituent at the para position relative to the aldehyde group. The oxime functional group, characterized by the presence of a nitrogen atom double-bonded to an oxygen atom and single-bonded to a carbon atom, contributes to the compound's reactivity, particularly in nucleophilic reactions. 4-Fluorobenzaldehyde oxime is often utilized in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its properties, such as solubility and boiling point, can vary based on environmental conditions and the presence of other functional groups in a reaction mixture.
Formula:C7H6FNO
InChI:InChI=1S/C7H6FNO/c8-7-3-1-6(2-4-7)5-9-10/h1-5,10H
InChI key:InChIKey=FSKSLWXDUJVTHE-UHFFFAOYSA-N
SMILES:C(=NO)C1=CC=C(F)C=C1
Synonyms:- 1-(4-fluorophenyl)-N-hydroxymethanimine
- 4-Fluorobenzaldehyde Oxime
- 4-Fluorobenzaldoxime
- Benzaldehyde, 4-fluoro-, oxime
- Benzaldehyde, p-fluoro-, oxime
- p-Fluorobenzaldehyde oxime
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Fluorobenzaldehyde Oxime
CAS:Formula:C7H6FNOPurity:98%Color and Shape:SolidMolecular weight:139.12704-Fluorobenzaldehyde Oxime
CAS:Formula:C7H6FNOPurity:>95.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:139.134-Fluorobenzaldehyde oxime
CAS:Formula:C7H6FNOPurity:95.0%Color and Shape:SolidMolecular weight:139.1294-Fluorobenzaldehyde oxime
CAS:4-Fluorobenzaldehyde oxime is a phenylhydrazine derivative that reacts with an aromatic amine to form a ternary complex. The reaction time for this process is short, and the yield of the product is high. 4-Fluorobenzaldehyde oxime also reacts with an aromatic amine to form an ion-pair. It can react with acidic hydrogen donors such as peracids and it also has high hydrogen bonding interactions. 4-Fluorobenzaldehyde oxime is used in pharmacological agents as well as other chemical reactions, including halogenation.
Formula:C7H6FNOPurity:Min. 95%Color and Shape:White PowderMolecular weight:139.13 g/mol




