CAS 459-31-4: 3-(4-Fluorophenyl)propionic acid
Description:3-(4-Fluorophenyl)propionic acid, with the CAS number 459-31-4, is an organic compound characterized by its propionic acid backbone substituted with a 4-fluorophenyl group at the third carbon position. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the fluorine atom enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The compound exhibits typical carboxylic acid properties, including the ability to donate protons (H+) in solution, which contributes to its acidity. Its molecular structure allows for potential interactions with biological targets, making it relevant in medicinal chemistry. Additionally, 3-(4-Fluorophenyl)propionic acid can be utilized in various synthetic applications, including the development of pharmaceuticals and agrochemicals, due to its functional groups that allow for further chemical modifications.
Formula:C9H9FO2
InChI:InChI=1S/C9H9FO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5H,3,6H2,(H,11,12)
InChI key:InChIKey=ZMKXWDPUXLPHCA-UHFFFAOYSA-N
SMILES:O=C(O)CCC1=CC=C(F)C=C1
- Synonyms:
- 3-(4-Fluorophenyl)Propanoate
- 3-(4-Fluorophenyl)Propanoic Acid
- 3-(p-Fluorophenyl)propionic acid
- 4-Fluorobenzenepropanoic acid
- 4-Fluorobenzylacetic acid
- Benzenepropanoic acid, 4-fluoro-
- Hydrocinnamic acid, p-fluoro-
- NSC 403021
- p-Fluorohydrocinnamic acid
