CAS 459-99-4

2-Fluoroethyl 2-fluoroacetate

Description:

2-Fluoroethyl 2-fluoroacetate is an organic compound characterized by its ester functional group, specifically an acetate, where both the ethyl and acetyl portions contain fluorine substituents. This compound typically appears as a colorless liquid with a distinctive odor. It is known for its moderate volatility and solubility in organic solvents, which makes it useful in various chemical applications. The presence of fluorine atoms enhances its reactivity and stability, making it a valuable intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, 2-fluoroethyl 2-fluoroacetate may exhibit unique properties such as increased lipophilicity and altered biological activity compared to its non-fluorinated counterparts. Safety considerations are important when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate precautions should be taken to minimize exposure. Overall, its unique chemical structure and properties make it a compound of interest in both research and industrial applications.

Formula: C₄H₆F₂O₂

InChI: InChI=1S/C4H6F2O2/c5-1-2-8-4(7)3-6/h1-3H2

InChI key: InChIKey=ZIJVALRYXQXDOL-UHFFFAOYSA-N

SMILES: C(OCCF)(CF)=O

Synonyms:

• Acetic acid, fluoro-, 2-fluoroethyl ester
• 2-Fluoroethyl 2-fluoroacetate
• Acetic acid, 2-fluoro-, 2-fluoroethyl ester