CAS 459137-97-4
:5-Amino-4-(1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-1,2-dihydro-3H-pyrrol-3-one
Description:
5-Amino-4-(1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-1,2-dihydro-3H-pyrrol-3-one is a synthetic organic compound characterized by its complex structure, which includes a pyrrolidine ring, a benzimidazole moiety, and a fluorophenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the amino group suggests it may participate in hydrogen bonding, influencing its reactivity and interactions with biological targets. The fluorine atom in the phenyl ring can enhance lipophilicity and metabolic stability, which are important for drug design. Additionally, the compound may exhibit specific pharmacological activities, potentially acting as an inhibitor or modulator in various biological pathways. Its unique structural features and functional groups contribute to its potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting specific diseases. As with many compounds, further studies would be necessary to fully elucidate its properties and biological effects.
Formula:C17H13FN4O
InChI:InChI=1S/C17H13FN4O/c18-10-5-7-11(8-6-10)22-9-14(23)15(16(22)19)17-20-12-3-1-2-4-13(12)21-17/h1-8H,9,19H2,(H,20,21)
InChI key:InChIKey=UHKVTDAMDJCTIL-UHFFFAOYSA-N
SMILES:NC1=C(C(=O)CN1C2=CC=C(F)C=C2)C=3NC=4C(N3)=CC=CC4
Synonyms:- 3H-Pyrrol-3-one, 5-amino-4-(1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-1,2-dihydro-
- 5-Amino-4-(1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-1,2-dihydro-3H-pyrrol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5-Amino-4-(1H-1,3-benzodiazol-2-yl)-1-(4-fluorophenyl)-2H-pyrrol-3-one
CAS:5-Amino-4-(1H-1,3-benzodiazol-2-yl)-1-(4-fluorophenyl)-2H-pyrrol-3-one
Molecular weight:308.30972g/molFGFR1 inhibitor-15
CAS:FGFR1inhibitor-15 (Compound 23) is an FGFR1 inhibitor with an IC50 value of 27 μM, useful for tumor research.Formula:C17H13FN4OColor and Shape:SolidMolecular weight:308.31


