CymitQuimica logo

CAS 4592-56-7

:

4-Amino-3-methyl-5-isothiazolecarboxylic acid

Description:
4-Amino-3-methyl-5-isothiazolecarboxylic acid is an organic compound characterized by its isothiazole ring, which contributes to its unique chemical properties. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), making it a potential candidate for various biochemical applications. The presence of the methyl group at the 3-position of the isothiazole ring influences its solubility and reactivity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to its functional groups. The compound is of interest in pharmaceutical research, particularly for its potential biological activities, including antimicrobial and anti-inflammatory properties. Its structure allows for various chemical modifications, which can enhance its efficacy or alter its pharmacokinetic properties. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use. Overall, 4-Amino-3-methyl-5-isothiazolecarboxylic acid represents a versatile building block in organic synthesis and medicinal chemistry.
Formula:C5H6N2O2S
InChI:InChI=1S/C5H6N2O2S/c1-2-3(6)4(5(8)9)10-7-2/h6H2,1H3,(H,8,9)
InChI key:InChIKey=LBAJXFHZXYACIP-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)C(C)=NS1
Synonyms:
  • 4-Amino-3-methylisothiazole-5-carboxylic acid
  • 5-Isothiazolecarboxylic acid, 4-amino-3-methyl-
  • 4-Amino-3-methyl-5-isothiazolecarboxylic acid
  • 4-aMino-3-Methyl-1,2-thiazole-5-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.