CAS 459216-21-8
:1-{isocyano[(4-methylphenyl)sulfonyl]methyl}-3-methylbenzene
Description:
1-{Isocyano[(4-methylphenyl)sulfonyl]methyl}-3-methylbenzene, identified by its CAS number 459216-21-8, is an organic compound characterized by the presence of an isocyanide functional group attached to a benzene ring. This compound features a sulfonyl group linked to a 4-methylphenyl moiety, which contributes to its unique reactivity and potential applications in organic synthesis. The presence of the isocyanide group imparts distinct nucleophilic properties, making it useful in various chemical reactions, including the formation of carbon-nitrogen bonds. Additionally, the methyl substituents on the benzene rings enhance the compound's lipophilicity and may influence its solubility and reactivity in different solvents. The sulfonyl group can also enhance the compound's stability and may participate in further chemical transformations. Overall, this compound exemplifies the complexity and versatility of organic molecules, particularly in the context of synthetic chemistry and material science.
Formula:C16H15NO2S
InChI:InChI=1/C16H15NO2S/c1-12-7-9-15(10-8-12)20(18,19)16(17-3)14-6-4-5-13(2)11-14/h4-11,16H,1-2H3
SMILES:Cc1ccc(cc1)S(=O)(=O)C(c1cccc(C)c1)[N+]#[C-]
Synonyms:- Benzene, 1-[Isocyano[(4-Methylphenyl)Sulfonyl]Methyl]-3-Methyl-
- Isocyano(3-methylphenyl)methyl 4-methylphenyl sulfone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.