CAS 459424-38-5
:Ethanaminium, N-(fluoromethyl)-2-hydroxy-N,N-dimethyl-, chloride (1:1)
Description:
Ethanaminium, N-(fluoromethyl)-2-hydroxy-N,N-dimethyl-, chloride (1:1) is a quaternary ammonium compound characterized by its unique structure, which includes a fluoromethyl group and a hydroxyl group attached to the ethanaminium backbone. This compound typically exhibits properties associated with quaternary ammonium salts, such as being a cationic surfactant, which can enhance its solubility in polar solvents and its ability to interact with biological membranes. The presence of the fluoromethyl group may impart specific reactivity and stability characteristics, potentially influencing its biological activity and pharmacokinetics. As a chloride salt, it is likely to be soluble in water and may exhibit ionic behavior in solution. The compound's applications could span various fields, including pharmaceuticals, where it may serve as an active ingredient or a precursor in drug synthesis. However, detailed safety and handling information, as well as specific applications, would require further investigation into its toxicological profile and regulatory status.
Formula:C5H13FNO·Cl
InChI:InChI=1S/C5H13FNO.ClH/c1-7(2,5-6)3-4-8;/h8H,3-5H2,1-2H3;1H/q+1;/p-1
InChI key:InChIKey=QJEHIIJVWXGJAB-UHFFFAOYSA-M
SMILES:[N+](CCO)(CF)(C)C.[Cl-]
Synonyms:- Dimethyl(Fluoromethyl)(2-Hydroxyethyl)Ammonium Chloride
- Ethanaminium, N-(Fluoromethyl)-2-Hydroxy-N,N-Dimethyl-, Chloride
- Ethanaminium, N-(fluoromethyl)-2-hydroxy-N,N-dimethyl-, chloride (1:1)
- FCH
- Fch Chloride
- Fluorochloline
- Fluorocholine Chloride
- Fluoromethylcholine Chloride
- N,N-Dimethyl-N-(Fluoromethyl) Ethanolammonium Chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ethanaminium,N-(fluoromethyl)-2-hydroxy-N,N-dimethyl-, chloride (9CI)
CAS:Formula:C5H13ClFNOPurity:98%Color and Shape:SolidMolecular weight:157.6142Fluorocholine chloride
CAS:Fluorocholine chlorideFormula:C5H13FNO·ClPurity:≥95%Color and Shape: white solidMolecular weight:157.61g/molFluoromethylcholine Chloride (>90%)
CAS:Controlled ProductApplications Fluoromethylcholine chloride (cas# 459424-38-5) is a useful research chemical.
Formula:C5H13ClFNOPurity:>90%Color and Shape:NeatMolecular weight:157.61Fluoromethylcholine chloride
CAS:Fluoromethylcholine chloride is a diagnostic agent that can be used for the diagnosis of prostate cancer. Fluoromethylcholine chloride is injected into the patient's body and then emits radiation from inside the tumor. The emitted radiation is detected by a camera, which creates an image of the tumor on a computer monitor. This imaging technique can also be used to detect liver lesions and other types of cancers such as brain tumors, breast cancer, and leukemia. Fluoromethylcholine chloride has been shown to have high uptake in prostate tissue and low uptake in normal tissues such as liver, kidney, or muscle.Formula:C5H13ClFNOColor and Shape:PowderMolecular weight:157.61 g/mol





