CAS 4595-61-3
:5-Pyrimidinecarboxylic acid
Description:
5-Pyrimidinecarboxylic acid, also known as 5-oxopyrimidine-2-carboxylic acid, is an organic compound characterized by a pyrimidine ring substituted with a carboxylic acid group at the 5-position. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, which makes it useful in various chemical applications. The presence of the carboxylic acid functional group contributes to its acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, 5-pyrimidinecarboxylic acid can serve as a building block in the synthesis of pharmaceuticals and agrochemicals, particularly in the development of nucleoside analogs and other biologically active compounds. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C5H4N2O2
InChI:InChI=1S/C5H4N2O2/c8-5(9)4-1-6-3-7-2-4/h1-3H,(H,8,9)
InChI key:InChIKey=IIVUJUOJERNGQX-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=NC=NC1
Synonyms:- 5-Carboxypyrimidine
- 5-Pyrimidinecarboxylic Acid
- 5-Pyrimidinecarboxylic acid (6CI,7CI,8CI,9CI)
- Akos 91242
- Pyrimidine-5-Carboxilic Acid
- Pyrimidine-5-carboxylic acid ,98%
- Rarechem Ak Ml 0570
- Pyrimidine-5-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Pyrimidine-5-carboxylic Acid
CAS:Formula:C5H4N2O2Purity:>97.0%(GC)(T)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:124.10Pyrimidine-5-carboxylic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C5H4N2O2Purity:95%Molecular weight:124.10pyrimidine-5-carboxylic acid
CAS:Formula:C5H4N2O2Purity:96%Color and Shape:SolidMolecular weight:124.0975Pyrimidine-5-carboxylic acid
CAS:Formula:C5H4N2O2Purity:95.0%Color and Shape:SolidMolecular weight:124.099Pyrimidine-5-carboxylic acid
CAS:Pyrimidine-5-carboxylic acidFormula:C5H4N2O2Purity:94%Color and Shape: light brown powderMolecular weight:124.10g/molPyrimidine-5-carboxylic acid
CAS:Pyrimidine-5-carboxylic acid is a synthetic, nucleophilic pyrimidine compound that is used in the laboratory for the synthesis of other compounds. It has been shown to inhibit the growth of Leishmania and Staphylococcus bacteria. Pyrimidine-5-carboxylic acid binds to the malonic acid moiety of phosphoenolpyruvate carboxykinase and inhibits its activity, leading to a reduction in cellular respiration. This drug also has clinical development potential as an analgesic with modulating properties.Formula:C5H4N2O2Purity:Min. 95%Molecular weight:124.1 g/mol








