CAS 4595-69-1
:4-chloro-6-methyl-2-(1-methylethyl)pyrimidine
Description:
4-Chloro-6-methyl-2-(1-methylethyl)pyrimidine, with the CAS number 4595-69-1, is a heterocyclic organic compound belonging to the pyrimidine family. This compound features a pyrimidine ring substituted with a chlorine atom at the 4-position, a methyl group at the 6-position, and an isopropyl group at the 2-position. Its molecular structure contributes to its unique chemical properties, including potential reactivity and solubility characteristics. Typically, pyrimidines exhibit basicity due to the presence of nitrogen atoms in the ring, which can participate in protonation reactions. The presence of the chlorine substituent can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the isopropyl group may affect the steric hindrance and overall stability of the molecule. This compound may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research and development.
Formula:C8H11ClN2
InChI:InChI=1/C8H11ClN2/c1-5(2)8-10-6(3)4-7(9)11-8/h4-5H,1-3H3
SMILES:CC(C)c1nc(C)cc(Cl)n1
Synonyms:- 4-Chloro-2-isopropyl-6-methylpyrimidine
- Pyrimidine, 4-Chloro-6-Methyl-2-(1-Methylethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
PYRIMIDINE, 4-CHLORO-6-METHYL-2-(1-METHYLETHYL)-
CAS:Formula:C8H11ClN2Purity:95%Color and Shape:LiquidMolecular weight:170.63934-Chloro-6-methyl-2-(propan-2-yl)pyrimidine
CAS:4-Chloro-6-methyl-2-(propan-2-yl)pyrimidinePurity:95%Molecular weight:170.64g/mol4-Chloro-2-isopropyl-6-methylpyrimidine
CAS:Controlled ProductApplications 4-Chloro-2-isopropyl-6-methylpyrimidine, is an intermediate used for the synthesis of some novel pyrimidine derivatives, having antifungal activities.
References Sun, L., et al.: Molecules, 16, 5618 (2011);Formula:C8H11ClN2Color and Shape:NeatMolecular weight:170.644-Chloro-6-methyl-2-(propan-2-yl)pyrimidine
CAS:4-Chloro-6-methyl-2-(propan-2-yl)pyrimidine is a pyrimidine derivative that is an antifungal agent. It has fungicidal and fungistatic activities against phytopathogenic fungi, inhibiting the synthesis of ergosterol, which is necessary for fungal cell membrane integrity. It also inhibits the enzyme squalene epoxidase, which is required for the production of sterols and other compounds in fungi. 4-Chloro-6-methyl-2-(propan-2-yl)pyrimidine has shown to be active against many strains of Aspergillus, including those resistant to other antifungals.Formula:C8H11ClN2Purity:Min. 95%Molecular weight:170.64 g/mol





