CAS 4596-51-4
:N-(ethoxycarbonyl)glycine
Description:
N-(ethoxycarbonyl)glycine, also known as ethyl carbamoyl glycine, is an amino acid derivative characterized by the presence of an ethoxycarbonyl group attached to the amino acid glycine. This compound features a carboxylic acid functional group, an amine group, and an ethoxycarbonyl moiety, which contributes to its unique properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. The presence of the ethoxycarbonyl group enhances its reactivity, making it useful in various chemical syntheses, particularly in the production of peptides and other bioactive compounds. N-(ethoxycarbonyl)glycine can participate in reactions such as esterification and amidation, and it may also serve as a building block in pharmaceutical chemistry. Its stability and reactivity profile make it a valuable intermediate in organic synthesis and medicinal chemistry. As with many chemical substances, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C5H9NO4
InChI:InChI=1/C5H9NO4/c1-2-10-5(9)6-3-4(7)8/h2-3H2,1H3,(H,6,9)(H,7,8)
SMILES:CCOC(=NCC(=O)O)O
Synonyms:- 2-[(Ethoxycarbonyl)Amino]Acetic Acid
- Glycine, N-(ethoxycarbonyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(Ethoxycarbonyl)glycine
CAS:Ethoxycarbonylglycine is an organic acid that is a β-amino acid ester. It is the sodium salt of ethoxycarbonylglycine and can be found as a white solid. It is synthesized from glycine, which is synthesized from nitrous acid, and methyl pentadecanoate in solvents such as chloroform and ether. Ethoxycarbonylglycine has been shown to have a chiral center at carbon atom 9. The molecule has two stereoisomers, which are mirror images of each other. The stereoisomers have different physical properties, such as melting point or boiling point. This compound also reacts with carbamic acid or carbamate to form reaction products.Formula:C5H9NO4Purity:Min. 95%Molecular weight:147.13 g/mol



