CAS 460053-62-7

1-(1H-pyrrolo[4,5-b]pyridin-3-yl)ethanone

Description:

1-(1H-pyrrolo[4,5-b]pyridin-3-yl)ethanone, with the CAS number 460053-62-7, is a chemical compound characterized by its unique bicyclic structure that incorporates both pyrrole and pyridine moieties. This compound typically exhibits a molecular formula that reflects its complex arrangement of carbon, hydrogen, and nitrogen atoms. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the ethanone functional group suggests that it may participate in various chemical reactions, including acylation and condensation. Additionally, the compound's aromatic nature contributes to its stability and reactivity, influencing its interactions with biological targets. Its solubility and behavior in different solvents can vary, impacting its application in research and industry. Overall, 1-(1H-pyrrolo[4,5-b]pyridin-3-yl)ethanone represents a fascinating subject for further study due to its structural complexity and potential pharmacological properties.

Formula: C₉H₈N₂O

InChI: InChI=1/C9H8N2O/c1-6(12)7-5-11-8-3-2-4-10-9(7)8/h2-5,11H,1H3

SMILES: CC(=O)c1c[nH]c2cccnc12

1-(1H-Pyrrolo[3,2-b]pyridin-3-yl)ethanone

CAS: 460053-62-7

Formula: C₉H₈N₂O

Molecular weight: 160.1726

Ref: IN-DA00DG8L

1-(1H-Pyrrolo[3,2-b]pyridin-3-yl)ethanone

CAS: 460053-62-7

1-(1H-Pyrrolo[3,2-b]pyridin-3-yl)ethanone

Purity: 95%

Molecular weight: 160.17g/mol

Ref: 54-OR914064

1-(1H-PYRROLO[3,2-B]PYRIDIN-3-YL)ETHANONE

CAS: 460053-62-7

Formula: C₉H₈N₂O

Purity: 97.0%

Molecular weight: 160.176

Ref: 10-F306832