CAS 4602-83-9

6,7-Dihydroxy-3,4-Dihydroisoquinoline

Description:

6,7-Dihydroxy-3,4-dihydroisoquinoline is an organic compound characterized by its isoquinoline structure, which features a bicyclic arrangement of carbon atoms. This compound contains two hydroxyl (-OH) groups at the 6 and 7 positions, contributing to its potential reactivity and solubility in polar solvents. The presence of these hydroxyl groups can enhance its ability to participate in hydrogen bonding, influencing its biological activity and interaction with other molecules. Typically, compounds like 6,7-dihydroxy-3,4-dihydroisoquinoline are of interest in medicinal chemistry due to their potential pharmacological properties, including neuroprotective and antioxidant effects. The compound's molecular structure allows it to interact with various biological targets, making it a subject of research in the fields of drug development and biochemical studies. Additionally, its CAS number, 4602-83-9, serves as a unique identifier for regulatory and safety information. Overall, this compound exemplifies the complexity and diversity of organic molecules with potential applications in health sciences.

Formula: C₉H₉NO₂

InChI: InChI=1/C9H9NO2/c11-8-3-6-1-2-10-5-7(6)4-9(8)12/h3-5,10,12H,1-2H2

SMILES: C1CNC=C2C=C(C(=O)C=C12)O

Synonyms:

• 6,7-Isoquinolinediol,3,4-dihydro-

6,7-Dihydroxy-3,4-dihydroisoquinoline

CAS: 4602-83-9

Formula: C₉H₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 163.1733

Ref: IN-DA00DBJ2

3,4-dihydroisoquinoline-6,7-diol

CAS: 4602-83-9

3,4-dihydroisoquinoline-6,7-diol

Purity: ≥95%

Molecular weight: 163.17g/mol

Ref: 54-OR24662

3,4-Dihydroisoquinoline-6,7-diol

CAS: 4602-83-9

Purity: 98%

Molecular weight: 163.1759949

Ref: 10-F773950

3,4-Dihydroisoquinoline-6,7-diol Hydrobromide

Controlled Product

CAS: 4602-83-9

Applications 3,4-Dihydroisoquinoline-6,7-diol acts as a reagent for the synthesis of 6,7-dihydroxy-3,4-dihydroisoquinline, a novel inhibitor factore-kB in invitro invasion in murine mammary cells.
References Alvarez, F. N., et al.: Chemotherapy, 55, 175 (2009)

Formula: C₉H₉NO₂·xHBr

Color and Shape: Neat

Molecular weight: 163.17

Ref: TR-D450740