CAS 4602-83-9: 6,7-Dihydroxy-3,4-Dihydroisoquinoline
Description:6,7-Dihydroxy-3,4-dihydroisoquinoline is an organic compound characterized by its isoquinoline structure, which features a bicyclic arrangement of carbon atoms. This compound contains two hydroxyl (-OH) groups at the 6 and 7 positions, contributing to its potential reactivity and solubility in polar solvents. The presence of these hydroxyl groups can enhance its ability to participate in hydrogen bonding, influencing its biological activity and interaction with other molecules. Typically, compounds like 6,7-dihydroxy-3,4-dihydroisoquinoline are of interest in medicinal chemistry due to their potential pharmacological properties, including neuroprotective and antioxidant effects. The compound's molecular structure allows it to interact with various biological targets, making it a subject of research in the fields of drug development and biochemical studies. Additionally, its CAS number, 4602-83-9, serves as a unique identifier for regulatory and safety information. Overall, this compound exemplifies the complexity and diversity of organic molecules with potential applications in health sciences.
Formula:C9H9NO2
InChI:InChI=1/C9H9NO2/c11-8-3-6-1-2-10-5-7(6)4-9(8)12/h3-5,10,12H,1-2H2
- Synonyms:
- 6,7-Isoquinolinediol,3,4-dihydro-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 6,7-DIHYDROXY-3,4-DIHYDROISOQUINOLINE REF: IN-DA00DBJ2CAS: 4602-83-9 | 98% | 112.00 €~247.00 € | Thu 17 Apr 25 |
 | 3,4-dihydroisoquinoline-6,7-diol REF: 54-OR24662CAS: 4602-83-9 | - - - | To inquire | Mon 21 Apr 25 |
 | 3,4-Dihydroisoquinoline-6,7-diol REF: TR-D450740CAS: 4602-83-9 | - - - | 155.00 €~339.00 € | Wed 28 May 25 |
 | 3,4-Dihydroisoquinoline-6,7-diol REF: 10-F773950CAS: 4602-83-9 | 98% | - - - | Discontinued product |
 | 3,4-Dihydro-6,7-isoquinolinediol REF: 3D-FD139294CAS: 4602-83-9 | Min. 95% | - - - | Discontinued product |
6,7-DIHYDROXY-3,4-DIHYDROISOQUINOLINE
Ref: IN-DA00DBJ2
| 100mg | 112.00 € |
3,4-Dihydroisoquinoline-6,7-diol
Controlled ProductRef: TR-D450740
| 1g | 339.00 € | ||
| 250mg | 155.00 € | ||
| 500mg | 212.00 € |
Ref: 10-F773950
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information |
3,4-Dihydro-6,7-isoquinolinediol
Ref: 3D-FD139294
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
