CAS 46035-71-6

2-(2-methoxy-5-methylphenyl)ethanamine

Description:

2-(2-Methoxy-5-methylphenyl)ethanamine, also known by its CAS number 46035-71-6, is an organic compound characterized by its amine functional group and aromatic structure. This compound features a two-carbon ethyl chain attached to a phenyl ring that is further substituted with a methoxy group and a methyl group, contributing to its unique chemical properties. The presence of the methoxy group enhances its solubility in organic solvents, while the methyl substitution on the phenyl ring can influence its reactivity and steric properties. As an amine, it can participate in various chemical reactions, including alkylation and acylation, and may exhibit basicity due to the nitrogen atom. The compound's structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis. However, specific biological activities, toxicity, and environmental impact would require further investigation to fully understand its implications in practical applications.

Formula: C₁₀H₁₅NO

InChI: InChI=1/C10H15NO/c1-8-3-4-10(12-2)9(7-8)5-6-11/h3-4,7H,5-6,11H2,1-2H3

SMILES: Cc1ccc(c(CCN)c1)OC

2-(2-Methoxy-5-methylphenyl)ethan-1-amine

Controlled Product

CAS: 46035-71-6

Versatile small molecule scaffold

Formula: C₁₀H₁₅NO

Purity: Min. 95%

Molecular weight: 165.23 g/mol

Ref: 3D-WBA03571