CymitQuimica logo

CAS 460363-30-8

:

2-(Cyclopentylamino)-3-pyridinecarboxylic acid

Description:
2-(Cyclopentylamino)-3-pyridinecarboxylic acid, identified by its CAS number 460363-30-8, is a chemical compound characterized by its unique structure, which includes a pyridine ring and a cyclopentylamino group. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential basicity due to the amino group and acidity from the carboxylic acid functional group. It is likely to be a solid at room temperature, with moderate solubility in polar solvents like water and alcohols, owing to the presence of the carboxylic acid. The compound may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where it may act as a bioactive agent or a building block for more complex molecules. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would need to be assessed through further studies.
Formula:C11H14N2O2
InChI:InChI=1S/C11H14N2O2/c14-11(15)9-6-3-7-12-10(9)13-8-4-1-2-5-8/h3,6-8H,1-2,4-5H2,(H,12,13)(H,14,15)
InChI key:InChIKey=BNPHCDCKTRSFKH-UHFFFAOYSA-N
SMILES:N(C1=C(C(O)=O)C=CC=N1)C2CCCC2
Synonyms:
  • 2-(Cyclopentylamino)nicotinic acid
  • 3-Pyridinecarboxylic acid, 2-(cyclopentylamino)-
  • 2-(Cyclopentylamino)-3-pyridinecarboxylic acid
Found 2 products.