CAS 46049-48-3

1-[(2R)-2,3-dihydro-1,4-benzodioxin-2-yl]methanamine

Description:

1-[(2R)-2,3-dihydro-1,4-benzodioxin-2-yl]methanamine, with the CAS number 46049-48-3, is an organic compound characterized by its unique structural features, including a benzodioxin moiety and an amine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and interactions. The presence of the benzodioxin structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The amine group can participate in hydrogen bonding, enhancing solubility in polar solvents and influencing its biological activity. Additionally, the stereochemistry indicated by the (2R) configuration may play a crucial role in the compound's pharmacological properties, as stereoisomers can exhibit significantly different behaviors in biological systems. Overall, this compound's characteristics make it a subject of interest in various fields, including organic synthesis and drug development.

Formula: C₉H₁₁NO₂

InChI: InChI=1/C9H11NO2/c10-5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,7H,5-6,10H2/t7-/m1/s1

SMILES: c1ccc2c(c1)OC[C@@H](CN)O2

Synonyms:

• 1,4-benzodioxin-2-methanamine, 2,3-dihydro-, (2R)-
• 1-[(2R)-2,3-Dihydro-1,4-benzodioxin-2-yl]methanamine

(R)-(2,3-Dihydrobenzo[b][1,4]dioxin-2-yl)methanamine

CAS: 46049-48-3

Formula: C₉H₁₁NO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 165.1891

Ref: IN-DA006XGJ

(R)-(2,3-Dihydrobenzo[b][1,4]dioxin-2-yl)methanamine

CAS: 46049-48-3

(R)-(2,3-Dihydrobenzo[b][1,4]dioxin-2-yl)methanamine

Purity: 95%

Molecular weight: 165.19g/mol

Ref: 54-OR86356

(R)-(2,3-Dihydrobenzo[b][1,4]dioxin-2-yl)methanamine

CAS: 46049-48-3

Formula: C₉H₁₁NO₂

Purity: 95%

Molecular weight: 165.192

Ref: 10-F324156