CAS 46054-70-0
:3,5-Dipropyl-1,2,4-triazol-4-ylamine
Description:
3,5-Dipropyl-1,2,4-triazol-4-ylamine is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features two propyl groups attached to the 3 and 5 positions of the triazole ring, contributing to its hydrophobic properties and potentially influencing its biological activity. The amine functional group at the 4 position enhances its reactivity and solubility in polar solvents. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential as a building block for more complex molecules or as a bioactive agent. Its unique structure may impart specific properties, such as antifungal or herbicidal activity, although detailed studies would be necessary to elucidate its full range of applications and mechanisms of action. As with many nitrogen-containing heterocycles, it may also exhibit interesting coordination chemistry with metal ions, making it relevant in materials science and catalysis.
Formula:C8H16N4
InChI:InChI=1/C8H16N4/c1-3-5-7-10-11-8(6-4-2)12(7)9/h3-6,9H2,1-2H3
SMILES:CCCc1nnc(CCC)n1N
Synonyms:- 3,5-dipropyl-4H-1,2,4-triazol-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
