CAS 460747-53-9: bromo-(4-chloro-3-methyl-phenyl)magnesium

Description:Bromo-(4-chloro-3-methyl-phenyl)magnesium, with the CAS number 460747-53-9, is an organomagnesium compound, specifically a Grignard reagent. It is characterized by the presence of a magnesium atom bonded to a phenyl group that is substituted with both a bromine atom and a chlorine atom, as well as a methyl group. This compound typically appears as a colorless to light yellow liquid or solid, depending on its form and purity. Grignard reagents are highly reactive, particularly with water and protic solvents, leading to the formation of hydrocarbons and magnesium hydroxides. They are commonly used in organic synthesis for the formation of carbon-carbon bonds, enabling the construction of complex molecules. The presence of halogen substituents in this compound can influence its reactivity and the types of reactions it can undergo, making it a valuable intermediate in various synthetic pathways. Proper handling and storage under an inert atmosphere are essential due to its sensitivity to moisture and air.

Formula:C₇H₆BrClMg

InChI:InChI=1/C7H6Cl.BrH.Mg/c1-6-4-2-3-5-7(6)8;;/h3-5H,1H3;1H;/q;;+1/p-1/rC7H6BrClMg/c1-5-4-6(10-8)2-3-7(5)9/h2-4H,1H3