CymitQuimica logo

CAS 4608-34-8

:

N,N'-bis(pyridin-2-ylmethyl)ethane-1,2-diamine

Description:
N,N'-bis(pyridin-2-ylmethyl)ethane-1,2-diamine, with the CAS number 4608-34-8, is a bidentate ligand featuring two pyridine rings attached to an ethylene diamine backbone. This compound is characterized by its ability to coordinate with metal ions, making it useful in coordination chemistry and catalysis. The presence of the pyridine moieties enhances its chelating properties, allowing it to form stable complexes with various transition metals. The compound is typically a solid at room temperature and exhibits solubility in polar solvents due to the presence of amine groups. Its structure contributes to its potential applications in fields such as medicinal chemistry, where it may serve as a building block for drug development or as a ligand in metal-based therapeutics. Additionally, the compound's properties can be influenced by the pH of the solution and the nature of the metal ions it interacts with, making it a versatile tool in synthetic and analytical chemistry.
Formula:C14H18N4
InChI:InChI=1/C14H18N4/c1-3-7-17-13(5-1)11-15-9-10-16-12-14-6-2-4-8-18-14/h1-8,15-16H,9-12H2
SMILES:c1ccnc(c1)CNCCNCc1ccccn1
Sort by

Found 1 products.