CAS 4609-10-3

5-(4-methoxyphenyl)-5-oxopentanoic acid

Description:

5-(4-Methoxyphenyl)-5-oxopentanoic acid, with the CAS number 4609-10-3, is an organic compound characterized by its structure, which includes a pentanoic acid backbone with a ketone and a methoxy-substituted phenyl group. This compound typically exhibits properties common to carboxylic acids, such as the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the methoxy group enhances its lipophilicity, potentially affecting its biological activity and interactions. The compound may also display acidic behavior due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. Its unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's stability, reactivity, and potential applications in synthesis or as an intermediate in organic reactions can be influenced by the substituents on the aromatic ring and the overall molecular configuration.

Formula: C₁₂H₁₄O₄

InChI: InChI=1/C12H14O4/c1-16-10-7-5-9(6-8-10)11(13)3-2-4-12(14)15/h5-8H,2-4H2,1H3,(H,14,15)

SMILES: COc1ccc(cc1)C(=O)CCCC(=O)O

Synonyms:

• Benzenepentanoic acid, 4-methoxy-delta-oxo-

5-(4-Methoxyphenyl)-5-oxopentanoic acid

CAS: 4609-10-3

Formula: C₁₂H₁₄O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 222.2372

Ref: IN-DA00DD9U

5-(4-Methoxyphenyl)-5-oxopentanoic acid

CAS: 4609-10-3

5-(4-Methoxyphenyl)-5-oxopentanoic acid

Purity: 98%

Molecular weight: 222.24g/mol

Ref: 54-OR1034410

5-(4-Methoxyphenyl)-5-oxovaleric acid

CAS: 4609-10-3

Formula: C₁₂H₁₄O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 222.24

Ref: 10-F022945