CAS 461-37-0
:2,2,2-trifluoroethyl carbamate
Description:
2,2,2-Trifluoroethyl carbamate is an organic compound characterized by the presence of a carbamate functional group attached to a trifluoroethyl moiety. Its molecular structure includes a carbon atom bonded to three fluorine atoms, which imparts significant electronegativity and influences its chemical reactivity and physical properties. This compound is typically a colorless liquid or solid, depending on the temperature and purity. It is known for its low volatility and relatively high stability under standard conditions. The trifluoromethyl group contributes to its lipophilicity, making it soluble in organic solvents while being less soluble in water. 2,2,2-Trifluoroethyl carbamate is often utilized in various applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, its unique properties may lend it potential uses in materials science and chemical research. However, handling precautions are necessary due to its potential toxicity and environmental impact, necessitating adherence to safety guidelines during use and disposal.
Formula:C3H4F3NO2
InChI:InChI=1/C3H4F3NO2/c4-3(5,6)1-9-2(7)8/h1H2,(H2,7,8)
SMILES:C(C(F)(F)F)OC(=N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.