CAS 461-81-4: 1-Chloro-4-(trifluoromethoxy)benzene
Description:1-Chloro-4-(trifluoromethoxy)benzene, with the CAS number 461-81-4, is an aromatic compound characterized by the presence of a chlorine atom and a trifluoromethoxy group attached to a benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its relatively low solubility in water but is soluble in organic solvents such as ethanol and ether. The trifluoromethoxy group contributes to its unique chemical properties, including increased electronegativity and potential reactivity in nucleophilic substitution reactions. This compound is often used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, it may exhibit specific environmental and health considerations, necessitating careful handling and storage. Overall, 1-Chloro-4-(trifluoromethoxy)benzene is a valuable compound in various chemical applications due to its distinctive functional groups and structural characteristics.
Formula:C7H4ClF3O
InChI:InChI=1S/C7H4ClF3O/c8-5-1-3-6(4-2-5)12-7(9,10)11/h1-4H
InChI key:InChIKey=SELFZOLQRDPBKC-UHFFFAOYSA-N
SMILES:FC(F)(F)OC1=CC=C(Cl)C=C1
- Synonyms:
- 1-Chloro-4-(trifluoromethoxy)benzene
- 1-Chloro-4-Trifluoromethxybenzene
- 4-Chloro Trifluoro Methoxy Benzene
- 4-Chloro(trifluoromethoxy)benzene
- 4-Chloro-α,α,α-trifluoroanisole
- 4-Chlorophenyl trifluoromethyl ether
- Anisole, p-chloro-α,α,α-trifluoro-
- Benzene, 1-chloro-4-(trifluoromethoxy)-
- p-Chloro(trifluoromethoxy)benzene

1-Chloro-4-(trifluoromethoxy)benzene
Ref: 3B-T2149
5g | 53.00 € |

Benzene, 1-chloro-4-(trifluoromethoxy)-
Ref: IN-DA00I8K7
1g | 25.00 € | ||
5g | 26.00 € | ||
25g | 28.00 € |

4-(Trifluoromethoxy)chlorobenzene
Ref: 54-PC7439A
25g | 32.00 € | ||
100g | 54.00 € | ||
500g | 168.00 € |

4-(Trifluoromethoxy)chlorobenzene
Ref: 10-F007556
1g | 29.00 € | ||
25g | To inquire | ||
100g | To inquire | ||
250g | To inquire |

4-(trifluoromethoxy)chlorobenzene
Ref: 3D-FT105270
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |