CymitQuimica logo

CAS 4610-75-7

:

ethyl 5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate

Description:
Ethyl 5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate, with the CAS number 4610-75-7, is a chemical compound that belongs to the class of benzofuran derivatives. This substance features a benzofuran core, which is characterized by a fused benzene and furan ring structure. The presence of a carboxylate group (ester) contributes to its solubility in organic solvents, while the hydroxyl group enhances its potential for hydrogen bonding, influencing its reactivity and interaction with other molecules. Ethyl 5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest potential applications in drug development, particularly in areas targeting specific biological pathways. The compound's stability, reactivity, and solubility characteristics are essential for its use in various chemical reactions and formulations. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C17H14O4
InChI:InChI=1/C17H14O4/c1-2-20-17(19)15-13-10-12(18)8-9-14(13)21-16(15)11-6-4-3-5-7-11/h3-10,18H,2H2,1H3
InChI key:WZZJQHPNLFLEMB-UHFFFAOYSA-N
SMILES:CCOC(=O)c1c2cc(ccc2oc1c1ccccc1)O
Synonyms:
  • 3-Benzofurancarboxylic acid, 5-hydroxy-2-phenyl-, ethyl ester
  • 5-Hydroxy-2-phenyl-benzofuran-3-carboxylic acid ethyl ester
  • Benzofuran-3-carboxylic acid, 5-hydroxy-2-phenyl-, ethyl ester
Found 5 products.